![]() | |
Names | |
---|---|
Preferred IUPAC name O,O-Diethyl O-[4-(methanesulfinyl)phenyl] phosphorothioate | |
Identifiers | |
3D model (JSmol) | |
ChemSpider | |
ECHA InfoCard | 100.003.741 |
PubChem CID | |
UNII | |
CompTox Dashboard (EPA) | |
| |
| |
Properties | |
C11H17O4PS2 | |
Molar mass | 308.35 g·mol−1 |
Appearance | Brown liquid or yellow oil [1] |
Density | 1.20 g/mL (20°C) [1] |
0.2% (25°C) | |
Hazards | |
Occupational safety and health (OHS/OSH): | |
Main hazards | combustible [1] |
NIOSH (US health exposure limits): | |
PEL (Permissible) | none [1] |
REL (Recommended) | TWA 0.1 mg/m3 [1] |
IDLH (Immediate danger) | N.D. [1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Fensulfothion is an organophosphorus compound with the formula CH2S(O)C6H4OP(S)(OC2H5)2. It is an insecticide and nematicide that acts by inhibiting the enzyme acetylcholinesterase. Chemically, it is classified as a thiophosphate. [2] It is widely used on corn, onions, rutabagas, pineapple, bananas, sugar cane, sugar beets, pea nuts, etc.
It is highly toxic and listed as an extremely hazardous substance. [3]