(2,4,6-Trimethylphenyl)gold

Last updated
(2,4,6-Trimethylphenyl)gold
Mesitylgold.svg
Pentameric form
Names
IUPAC name
(2,4,6-Trimethylphenyl)gold
Other names
Mesitylgold; Mesitylgold(I); (2,4,6-Trimethylphenyl)gold(I)
Identifiers
3D model (JSmol)
ChemSpider
PubChem CID
  • InChI=1S/C9H11.Au/c1-7-4-8(2)6-9(3)5-7;/h4-5H,1-3H3; Yes check.svgY
    Key: VUMCLWYYCJSHBH-UHFFFAOYSA-N Yes check.svgY
  • monomer:CC1=CC(C)=C([Au])C(C)=C1
  • pentamer:[Au+]1[C-]2(=C(C)C=C(C)C=C2(C))[Au+][C-]3(=C(C)C=C(C)C=C3(C))[Au+][C-]4(=C(C)C=C(C)C=C4(C))[Au+][C-]5(=C(C)C=C(C)C=C5(C))[Au+][C-]16(=C(C)C=C(C)C=C6(C))
Properties
AuC
9
H
11
Molar mass 316.15 g mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
X mark.svgN  verify  (what is  Yes check.svgYX mark.svgN ?)

(2,4,6-Trimethylphenyl)gold is a member of a special group of compounds where an aryl carbon atom acts as a bridge between two gold atoms. This compound is formed in a reaction between Au(CO)Cl and the Grignard reagent mesitylmagnesium bromide. [1] It crystallizes as a cyclical pentamer. [1]

Related Research Articles

Chemistry is the scientific study of the properties and behavior of matter. It is a physical science within the natural sciences that studies the chemical elements that make up matter and compounds made of atoms, molecules and ions: their composition, structure, properties, behavior and the changes they undergo during reactions with other substances. Chemistry also addresses the nature of chemical bonds in chemical compounds.

A chemical element is a chemical substance that cannot be broken down into other substances by chemical reactions. The basic particle that constitutes a chemical element is the atom. Elements are identified by the number of protons in their nucleus, known as the element's atomic number. For example, oxygen has an atomic number of 8, meaning each oxygen atom has 8 protons in its nucleus. Atoms of the same element can have different numbers of neutrons in their nuclei, known as isotopes of the element. Two or more atoms can combine to form molecules. Chemical compounds are molecules made of atoms of different elements, while mixtures contain atoms of different elements not necessarily combined as molecules. Atoms can be transformed into different elements in nuclear reactions, which change an atom's atomic number.

A chemical formula is a way of presenting information about the chemical proportions of atoms that constitute a particular chemical compound or molecule, using chemical element symbols, numbers, and sometimes also other symbols, such as parentheses, dashes, brackets, commas and plus (+) and minus (−) signs. These are limited to a single typographic line of symbols, which may include subscripts and superscripts. A chemical formula is not a chemical name since it does not contain any words. Although a chemical formula may imply certain simple chemical structures, it is not the same as a full chemical structural formula. Chemical formulae can fully specify the structure of only the simplest of molecules and chemical substances, and are generally more limited in power than chemical names and structural formulae.

Electronegativity, symbolized as χ, is the tendency for an atom of a given chemical element to attract shared electrons when forming a chemical bond. An atom's electronegativity is affected by both its atomic number and the distance at which its valence electrons reside from the charged nucleus. The higher the associated electronegativity, the more an atom or a substituent group attracts electrons. Electronegativity serves as a simple way to quantitatively estimate the bond energy, and the sign and magnitude of a bond's chemical polarity, which characterizes a bond along the continuous scale from covalent to ionic bonding. The loosely defined term electropositivity is the opposite of electronegativity: it characterizes an element's tendency to donate valence electrons.

<span class="mw-page-title-main">Ionic bonding</span> Chemical bonding involving attraction between ions

Ionic bonding is a type of chemical bonding that involves the electrostatic attraction between oppositely charged ions, or between two atoms with sharply different electronegativities, and is the primary interaction occurring in ionic compounds. It is one of the main types of bonding, along with covalent bonding and metallic bonding. Ions are atoms with an electrostatic charge. Atoms that gain electrons make negatively charged ions. Atoms that lose electrons make positively charged ions. This transfer of electrons is known as electrovalence in contrast to covalence. In the simplest case, the cation is a metal atom and the anion is a nonmetal atom, but these ions can be more complex, e.g. molecular ions like NH+
4
or SO2−
4
. In simpler words, an ionic bond results from the transfer of electrons from a metal to a non-metal to obtain a full valence shell for both atoms.

<span class="mw-page-title-main">Molecule</span> Electrically neutral group of two or more atoms

A molecule is a group of two or more atoms held together by attractive forces known as chemical bonds; depending on context, the term may or may not include ions which satisfy this criterion. In quantum physics, organic chemistry, and biochemistry, the distinction from ions is dropped and molecule is often used when referring to polyatomic ions.

In chemistry, peroxides are a group of compounds with the structure R−O−O−R, where the R's represent a radical and O's are single oxygen atoms. Oxygen atoms are joined to each other and to adjacent elements through single covalent bonds, denoted by dashes or lines. The O−O group in a peroxide is often called the peroxide group, though some nomenclature discrepancies exist. This linkage is recognized as a common polyatomic ion, and exists in many molecules.

In chemistry, the oxidation state, or oxidation number, is the hypothetical charge of an atom if all of its bonds to other atoms were fully ionic. It describes the degree of oxidation of an atom in a chemical compound. Conceptually, the oxidation state may be positive, negative or zero. While fully ionic bonds are not found in nature, many bonds exhibit strong ionicity, making oxidation state a useful predictor of charge.

In coordination chemistry, a coordinate covalent bond, also known as a dative bond, dipolar bond, or coordinate bond is a kind of two-center, two-electron covalent bond in which the two electrons derive from the same atom. The bonding of metal ions to ligands involves this kind of interaction. This type of interaction is central to Lewis acid–base theory.

<span class="mw-page-title-main">Molar mass</span> Mass per amount of substance

In chemistry, the molar mass of a chemical compound is defined as the ratio between the mass and the amount of substance of any sample of the compound. The molar mass is a bulk, not molecular, property of a substance. The molar mass is an average of many instances of the compound, which often vary in mass due to the presence of isotopes. Most commonly, the molar mass is computed from the standard atomic weights and is thus a terrestrial average and a function of the relative abundance of the isotopes of the constituent atoms on Earth. The molar mass is appropriate for converting between the mass of a substance and the amount of a substance for bulk quantities.

In chemistry, the valence or valency of an atom is a measure of its combining capacity with other atoms when it forms chemical compounds or molecules. Valence is generally understood to be the number of chemical bonds that each atom of a given chemical element typically forms. Double bonds are considered to be two bonds, triple bonds to be three, quadruple bonds to be four, quintuple bonds to be five and sextuple bonds to be six. In most compounds, the valence of hydrogen is 1, of oxygen is 2, of nitrogen is 3, and of carbon is 4. Valence is not to be confused with the related concepts of the coordination number, the oxidation state, or the number of valence electrons for a given atom.

In chemistry, bond energy (BE) is one measure of the strength of a chemical bond. It is sometimes called the mean bond, bond enthalpy, average bond enthalpy, or bond strength. IUPAC defines bond energy as the average value of the gas-phase bond-dissociation energy for all bonds of the same type within the same chemical species.

Chemical nomenclature is a set of rules to generate systematic names for chemical compounds. The nomenclature used most frequently worldwide is the one created and developed by the International Union of Pure and Applied Chemistry (IUPAC).

<span class="mw-page-title-main">Cyclic compound</span> Molecule with a ring of bonded atoms

A cyclic compound is a term for a compound in the field of chemistry in which one or more series of atoms in the compound is connected to form a ring. Rings may vary in size from three to many atoms, and include examples where all the atoms are carbon, none of the atoms are carbon, or where both carbon and non-carbon atoms are present. Depending on the ring size, the bond order of the individual links between ring atoms, and their arrangements within the rings, carbocyclic and heterocyclic compounds may be aromatic or non-aromatic; in the latter case, they may vary from being fully saturated to having varying numbers of multiple bonds between the ring atoms. Because of the tremendous diversity allowed, in combination, by the valences of common atoms and their ability to form rings, the number of possible cyclic structures, even of small size numbers in the many billions.

<span class="mw-page-title-main">Chemical substance</span> Form of matter

A chemical substance is a unique form of matter with constant chemical composition and characteristic properties. Chemical substances may take the form of a single element or chemical compounds. If two or more chemical substances can be combined without reacting, they may form a chemical mixture. If a mixture is separated to isolate one chemical substance to a desired degree, the resulting substance is said to be chemically pure.

This glossary of chemistry terms is a list of terms and definitions relevant to chemistry, including chemical laws, diagrams and formulae, laboratory tools, glassware, and equipment. Chemistry is a physical science concerned with the composition, structure, and properties of matter, as well as the changes it undergoes during chemical reactions; it features an extensive vocabulary and a significant amount of jargon.

<span class="mw-page-title-main">Isomer</span> Chemical compounds with the same molecular formula but different atomic arrangements

In chemistry, isomers are molecules or polyatomic ions with identical molecular formula – that is, the same number of atoms of each element – but distinct arrangements of atoms in space. Isomerism refers to the existence or possibility of isomers.

<span class="mw-page-title-main">Chemical compound</span> Substance composed of multiple elements that are chemically bonded

A chemical compound is a chemical substance composed of many identical molecules containing atoms from more than one chemical element held together by chemical bonds. A molecule consisting of atoms of only one element is therefore not a compound. A compound can be transformed into a different substance by a chemical reaction, which may involve interactions with other substances. In this process, bonds between atoms may be broken and/or new bonds formed.

In chemistry, a ring is an ambiguous term referring either to a simple cycle of atoms and bonds in a molecule or to a connected set of atoms and bonds in which every atom and bond is a member of a cycle. A ring system that is a simple cycle is called a monocycle or simple ring, and one that is not a simple cycle is called a polycycle or polycyclic ring system. A simple ring contains the same number of sigma bonds as atoms, and a polycyclic ring system contains more sigma bonds than atoms.

In chemical nomenclature, a descriptor is a notational prefix placed before the systematic substance name, which describes the configuration or the stereochemistry of the molecule. Some of the listed descriptors should not be used in publications, as they no longer accurately correspond with the recommendations of the IUPAC. Stereodescriptors are often used in combination with locants to clearly identify a chemical structure unambiguously.

References

  1. 1 2 Gambarotta, Sandro; Floriani, Carlo; Chiesi-Villa, Angiola; Guastini, Carlo (1983). "A homoleptic arylgold(I) complex: Synthesis and structure of pentanuclear mesitylgold(I)". Journal of the Chemical Society, Chemical Communications (22): 1304. doi:10.1039/C39830001304.