Rhamnazin

Last updated
Rhamnazin
Rhamnazin.svg
Rhamnazin 3D BS.png
Names
IUPAC name
3,4′,5-Trihydroxy-3′,7-dimethoxyflavone
Systematic IUPAC name
3,5-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one
Other names
3′,7-Dimethylquercetin
3,5,4′-Trihydroxy-7,3′-dimethoxyflavone
5,3′,4′-Trihydroxy-3,7-dimethoxyflavone
Flavone, 3,4′,5-trihydroxy-3′,7-dimethoxy-
Identifiers
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
PubChem CID
UNII
  • InChI=1S/C17H14O7/c1-22-9-6-11(19)14-13(7-9)24-17(16(21)15(14)20)8-3-4-10(18)12(5-8)23-2/h3-7,18-19,21H,1-2H3 X mark.svgN
    Key: MYMGKIQXYXSRIJ-UHFFFAOYSA-N X mark.svgN
  • InChI=1/C17H14O7/c1-22-9-6-11(19)14-13(7-9)24-17(16(21)15(14)20)8-3-4-10(18)12(5-8)23-2/h3-7,18-19,21H,1-2H3
    Key: MYMGKIQXYXSRIJ-UHFFFAOYAP
  • COC1=CC(=C2C(=C1)OC(=C(C2=O)O)C3=CC(=C(C=C3)O)OC)O
Properties
C17H14O7
Molar mass 330.292 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
X mark.svgN  verify  (what is  Yes check.svgYX mark.svgN ?)

Rhamnazin is an O-methylated flavonol, a type of chemical compound. It can be found in Rhamnus petiolaris , [1] a buckthorn plant endemic to Sri Lanka.

Contents

Metabolism

The enzyme 3-methylquercetin 7-O-methyltransferase uses S-adenosyl methionine and isorhamnetin to produce S-adenosyl homocysteine and rhamnazin.

The enzyme 3,7-dimethylquercetin 4'-O-methyltransferase uses S-adenosyl methionine and rhamnazin to produce S-adenosyl homocysteine and ayanin.

Related Research Articles

In enzymology, a 3,7-dimethylquercetin 4'-O-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a 3'-demethylstaurosporine O-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a 3-methylquercetin 7-O-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a 8-hydroxyquercetin 8-O-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, an apigenin 4'-O-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a demethylsterigmatocystin 6-O-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a hexaprenyldihydroxybenzoate methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a homocysteine S-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, an indolepyruvate C-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, an inositol 3-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a loganate O-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a luteolin O-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a macrocin O-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a methylquercetagetin 6-O-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a quercetin 3-O-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a sterigmatocystin 8-O-methyltransferase is an enzyme that catalyzes the chemical reaction

In enzymology, a tyramine N-methyltransferase is an enzyme that catalyzes the chemical reaction

8-hydroxyfuranocoumarin 8-O-methyltransferase is an enzyme with systematic name S-adenosyl-L-methionine:8-hydroxyfurocoumarin 8-O-methyltransferase. This enzyme catalyses the following chemical reaction

Tricetin 3',4',5'-O-trimethyltransferase is an enzyme with systematic name S-adenosyl-L-methionine:tricetin 3',4',5'-O-trimethyltransferase. This enzyme catalyses the following chemical reaction

Trans-resveratrol di-O-methyltransferase is an enzyme with systematic name S-adenosyl-L-methionine:trans-resveratrol 3,5-O-dimethyltransferase. This enzyme catalyses the following chemical reaction

References

  1. ↑ Wagner, H.; Ertan, M.; Seligmann, O. (1974). "Rhamnazin- und rhamnetin-3-O-trioside aus Rhamnus petiolaris". Phytochemistry (in German). 13 (5): 857–860. doi:10.1016/S0031-9422(00)91151-8.
This page is based on this Wikipedia article
Text is available under the CC BY-SA 4.0 license; additional terms may apply.
Images, videos and audio are available under their respective licenses.