|   | |
| Names | |
|---|---|
| Other names (E)-5,6,16-octadecatrienoic acid | |
| Identifiers | |
| 3D model (JSmol) | |
| ChEBI | |
| ChemSpider | |
|  PubChem CID | |
| 
 | |
| 
 | |
| Properties | |
| C18H30O2 | |
| Molar mass | 278.436 g·mol−1 | 
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
Lamenallenic acid is a linear octadecatrienic fatty acid with the structural formula CH3-CH=CH-(CH2)8-CH=C=CH-(CH2)3-COOH. [1] The delta notation is 18:3-delta-5,6allene,16t. [2] This is one of the rare allenic fatty acids found in nature, probably biosynthesized from laballenic acid. [3]
Some authors have attributed the cis-configuration to the double bond in the position 16=17.
The allene group is responsible for the marked optical activity of the acid. Lamenallenic acid is levorotatory with (R)-configuration. [4]
The acid was initially isolated in 1967 by Mikolajczak, Rogers, Smith, and Wolff in the seed oil of Lamium purpureum (10-16%), a plant of the Lamiaceae family. [5] [6] The compound is also found in the seed oil of other Lamiaceae: Lamium maculatum (~8%), Lamium album (~5%), Lamium amplexicaule (~5%). [7]
The acid can be obtained by a highly enantioselective synthesis, utilizing the recently developed EATA (enantioselective allenylation of terminal alkynes) reaction and aerobic oxidation reaction. [8]