Medrylamine

Medrylamine

Identifiers
IUPAC name 2-[(4-methoxyphenyl)-phenylmethoxy]-N,N-dimethylethanamine
CAS Number	524-99-2  Y
PubChem CID	10669
ChemSpider	10219  Y
UNII	5R003655CR
ChEBI	CHEBI:135181
ChEMBL	ChEMBL2104714  Y
CompTox Dashboard (EPA)	DTXSID10862116
ECHA InfoCard	100.007.609
Chemical and physical data
Formula	C18H23NO2
Molar mass	285.387 g·mol−1
3D model (JSmol)	Interactive image
SMILES CN(C)CCOC(c1ccccc1)c2ccc(cc2)OC
InChI InChI=InChI=1S/C18H23NO2/c1-19(2)13-14-21-18(15-7-5-4-6-8-15)16-9-11-17(20-3)12-10-16/h4-12,18H,13-14H2,1-3H3 Y Key:BXCMCXBSUDRYPF-UHFFFAOYSA-N Y

Medrylamine is an antihistamine related to diphenhydramine. ^{[1] [2]}

References

1. US 2668856,Morren H,"P-methoxy benzhydryl ethers",issued 1954, assigned to UCB SA. 
2. Wolff ME (1995). Burger's Medicinal Chemistry and Drug Discovery, Therapeutic Agents. Vol. 5 (5th ed.). New York: Wiley. p. 518. ISBN   978-0-471-57560-3.